* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL035146 |
English Synonyms: | SYNTHON-LAB SL035146 |
MDL Number.: | MFCD03992909 |
H bond acceptor: | 9 |
H bond donor: | 3 |
Smile: | Cc1ccc(cc1)NC(=O)CN2C(=O)/C(=C\c3ccccc3OCC(=O)O)/NC2=O |
InChi: | InChI=1S/C21H19N3O6/c1-13-6-8-15(9-7-13)22-18(25)11-24-20(28)16(23-21(24)29)10-14-4-2-3-5-17(14)30-12-19(26)27/h2-10H,11-12H2,1H3,(H,22,25)(H,23,29)(H,26,27)/b16-10+ |
InChiKey: | InChIKey=PUSYMNDFMNENPK-MHWRWJLKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.