* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL082536 |
English Synonyms: | SYNTHON-LAB SL082536 |
MDL Number.: | MFCD03993011 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | CCOc1cc(cc(c1OCC#C)Cl)/C=N/N2C(=O)C3C4C=CC(C3C2=O)C5C4C5 |
InChi: | InChI=1S/C23H21ClN2O4/c1-3-7-30-21-17(24)8-12(9-18(21)29-4-2)11-25-26-22(27)19-13-5-6-14(16-10-15(13)16)20(19)23(26)28/h1,5-6,8-9,11,13-16,19-20H,4,7,10H2,2H3/b25-11+ |
InChiKey: | InChIKey=VSXSWWHUESONNS-OPEKNORGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.