* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL035061 |
English Synonyms: | SYNTHON-LAB SL035061 |
MDL Number.: | MFCD03993086 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | COC(=O)CN1C(=O)/C(=C\c2cc(c(c(c2)Cl)OCC#C)Cl)/SC1=O |
InChi: | InChI=1S/C16H11Cl2NO5S/c1-3-4-24-14-10(17)5-9(6-11(14)18)7-12-15(21)19(16(22)25-12)8-13(20)23-2/h1,5-7H,4,8H2,2H3/b12-7+ |
InChiKey: | InChIKey=PECDYWCZRYTFFQ-KPKJPENVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.