* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL035068 |
English Synonyms: | SYNTHON-LAB SL035068 |
MDL Number.: | MFCD03993092 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | CCOc1cc(cc(c1OCC#C)CC=C)/C=C/2\C(=O)N(C(=O)S2)CC(=O)OC |
InChi: | InChI=1S/C21H21NO6S/c1-5-8-15-10-14(11-16(27-7-3)19(15)28-9-6-2)12-17-20(24)22(21(25)29-17)13-18(23)26-4/h2,5,10-12H,1,7-9,13H2,3-4H3/b17-12+ |
InChiKey: | InChIKey=MIJYDVBJRFYTAW-SFQUDFHCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.