* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL069734 |
English Synonyms: | SYNTHON-LAB SL069734 |
MDL Number.: | MFCD03993257 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CCOc1cc(cc(c1OC(=O)C)Cl)/C=C\2/C(=O)SC(=N2)SCc3ccccc3 |
InChi: | InChI=1S/C21H18ClNO4S2/c1-3-26-18-11-15(9-16(22)19(18)27-13(2)24)10-17-20(25)29-21(23-17)28-12-14-7-5-4-6-8-14/h4-11H,3,12H2,1-2H3/b17-10- |
InChiKey: | InChIKey=BJMVLERFDMGDIL-YVLHZVERSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.