* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL069164 |
| English Synonyms: | SYNTHON-LAB SL069164 |
| MDL Number.: | MFCD03993623 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CCCSC1=N/C(=C\c2cc3c(cc2Br)OCO3)/C(=O)S1 |
| InChi: | InChI=1S/C14H12BrNO3S2/c1-2-3-20-14-16-10(13(17)21-14)4-8-5-11-12(6-9(8)15)19-7-18-11/h4-6H,2-3,7H2,1H3/b10-4- |
| InChiKey: | InChIKey=OUHLAWOTJIHAFI-WMZJFQQLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.