* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL084869 |
English Synonyms: | SYNTHON-LAB SL084869 |
MDL Number.: | MFCD03996145 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | CCn1c(nnc1SCC(=O)Nc2cc(ccc2Cl)C(F)(F)F)CNC(=O)Cc3ccc(cc3)OC |
InChi: | InChI=1S/C23H23ClF3N5O3S/c1-3-32-19(12-28-20(33)10-14-4-7-16(35-2)8-5-14)30-31-22(32)36-13-21(34)29-18-11-15(23(25,26)27)6-9-17(18)24/h4-9,11H,3,10,12-13H2,1-2H3,(H,28,33)(H,29,34) |
InChiKey: | InChIKey=YHVCWYMHKNBFAX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.