* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL086342 |
English Synonyms: | SYNTHON-LAB SL086342 |
MDL Number.: | MFCD03996193 |
H bond acceptor: | 10 |
H bond donor: | 2 |
Smile: | CCn1c(nnc1SCC(=O)Nc2ccc(cc2)C(=O)OC)CNC(=O)Cc3ccc(cc3)OC |
InChi: | InChI=1S/C24H27N5O5S/c1-4-29-20(14-25-21(30)13-16-5-11-19(33-2)12-6-16)27-28-24(29)35-15-22(31)26-18-9-7-17(8-10-18)23(32)34-3/h5-12H,4,13-15H2,1-3H3,(H,25,30)(H,26,31) |
InChiKey: | InChIKey=QTLLMOZQZUDMBJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.