* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL086187 |
English Synonyms: | SYNTHON-LAB SL086187 |
MDL Number.: | MFCD03996270 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | CCn1c(nnc1SCC(=O)Nc2cc(cc(c2)Cl)Cl)C(C)NC(=O)c3ccccc3 |
InChi: | InChI=1S/C21H21Cl2N5O2S/c1-3-28-19(13(2)24-20(30)14-7-5-4-6-8-14)26-27-21(28)31-12-18(29)25-17-10-15(22)9-16(23)11-17/h4-11,13H,3,12H2,1-2H3,(H,24,30)(H,25,29) |
InChiKey: | InChIKey=BQNXDSUOIVTJTR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.