* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL085643 |
English Synonyms: | SYNTHON-LAB SL085643 |
MDL Number.: | MFCD03996312 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | Cc1cccc(c1)C(=O)NCc2nnc(n2C)SCC(=O)Nc3cc(cc(c3)Cl)Cl |
InChi: | InChI=1S/C20H19Cl2N5O2S/c1-12-4-3-5-13(6-12)19(29)23-10-17-25-26-20(27(17)2)30-11-18(28)24-16-8-14(21)7-15(22)9-16/h3-9H,10-11H2,1-2H3,(H,23,29)(H,24,28) |
InChiKey: | InChIKey=DIAKILWALKAMNR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.