* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL086185 |
English Synonyms: | SYNTHON-LAB SL086185 |
MDL Number.: | MFCD03996529 |
H bond acceptor: | 9 |
H bond donor: | 2 |
Smile: | CCn1c(nnc1SCC(=O)Nc2ccc(cc2)C(=O)OCC)C(C)NC(=O)c3ccccc3 |
InChi: | InChI=1S/C24H27N5O4S/c1-4-29-21(16(3)25-22(31)17-9-7-6-8-10-17)27-28-24(29)34-15-20(30)26-19-13-11-18(12-14-19)23(32)33-5-2/h6-14,16H,4-5,15H2,1-3H3,(H,25,31)(H,26,30) |
InChiKey: | InChIKey=OFSMRNNLCXTHBJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.