* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL094879 |
English Synonyms: | SYNTHON-LAB SL094879 |
MDL Number.: | MFCD04008136 |
H bond acceptor: | 8 |
H bond donor: | 0 |
Smile: | CCOc1ccc(cc1OC)/C=c\2/c(=O)n3c(s2)nc(n3)c4ccc(c(c4)OC)OC |
InChi: | InChI=1S/C22H21N3O5S/c1-5-30-16-8-6-13(10-17(16)28-3)11-19-21(26)25-22(31-19)23-20(24-25)14-7-9-15(27-2)18(12-14)29-4/h6-12H,5H2,1-4H3/b19-11- |
InChiKey: | InChIKey=UXYXLAAOJCIWQN-ODLFYWEKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.