* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL094527 |
English Synonyms: | SYNTHON-LAB SL094527 |
MDL Number.: | MFCD04008177 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | COc1cc(ccc1O)/C=C\2/C(=O)N=C(S2)N3CCN(CC3)c4ccccc4F |
InChi: | InChI=1S/C21H20FN3O3S/c1-28-18-12-14(6-7-17(18)26)13-19-20(27)23-21(29-19)25-10-8-24(9-11-25)16-5-3-2-4-15(16)22/h2-7,12-13,26H,8-11H2,1H3/b19-13- |
InChiKey: | InChIKey=LOIXYIIMQYSTRU-UYRXBGFRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.