* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL037875 |
| English Synonyms: | SYNTHON-LAB SL037875 |
| MDL Number.: | MFCD04014971 |
| H bond acceptor: | 7 |
| H bond donor: | 0 |
| Smile: | c1ccc2c(c1)c(cn2Cc3ccc(cc3)F)/C=C/4\C(=O)N(C(=O)S4)CC(=O)N5CCOCC5 |
| InChi: | InChI=1S/C25H22FN3O4S/c26-19-7-5-17(6-8-19)14-28-15-18(20-3-1-2-4-21(20)28)13-22-24(31)29(25(32)34-22)16-23(30)27-9-11-33-12-10-27/h1-8,13,15H,9-12,14,16H2/b22-13+ |
| InChiKey: | InChIKey=FHWCZWMUUXTEQH-LPYMAVHISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.