* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL032478 |
English Synonyms: | SYNTHON-LAB SL032478 |
MDL Number.: | MFCD04015716 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | Cc1cccc(c1)N2C(=O)/C(=C\c3cccn3c4cccc(c4)C(=O)O)/C(=O)NC2=S |
InChi: | InChI=1S/C23H17N3O4S/c1-14-5-2-8-18(11-14)26-21(28)19(20(27)24-23(26)31)13-17-9-4-10-25(17)16-7-3-6-15(12-16)22(29)30/h2-13H,1H3,(H,29,30)(H,24,27,31)/b19-13- |
InChiKey: | InChIKey=RKPDHNMMQZBGGG-UYRXBGFRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.