* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL034278 |
| English Synonyms: | SYNTHON-LAB SL034278 |
| MDL Number.: | MFCD04015921 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | COc1cc(c(cc1N2CCCC2)OC)/C=C(\C#N)/C(=O)NCCc3c[nH]c4c3cccc4 |
| InChi: | InChI=1S/C26H28N4O3/c1-32-24-15-23(30-11-5-6-12-30)25(33-2)14-19(24)13-20(16-27)26(31)28-10-9-18-17-29-22-8-4-3-7-21(18)22/h3-4,7-8,13-15,17,29H,5-6,9-12H2,1-2H3,(H,28,31)/b20-13+ |
| InChiKey: | InChIKey=WNPLXWAYIBFJQX-DEDYPNTBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.