Molecular Structure:
CCD No.:CCD00439076
BUTTPARK 143\41-51
Formula:C16 H16 N6 O3 S2
MolWeight:404.473
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | BUTTPARK 143\41-51 |
| English Synonyms： | BUTTPARK 143\41-51 |
| MDL Number.： | MFCD04022655 |
| H bond acceptor： | 9 |
| H bond donor： | 2 |
| Smile： | Cn1c(nnc1SCC(=O)Nc2ccc(cc2)S(=O)(=O)N)c3ccncc3 |
| InChi： | InChI=1S/C16H16N6O3S2/c1-22-15(11-6-8-18-9-7-11)20-21-16(22)26-10-14(23)19-12-2-4-13(5-3-12)27(17,24)25/h2-9H,10H2,1H3,(H,19,23)(H2,17,24,25) |
| InChiKey： | InChIKey=CPSSUBQJKMSWAI-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
