* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL032377 |
English Synonyms: | SYNTHON-LAB SL032377 |
MDL Number.: | MFCD04022779 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | Cc1cc(c(n1c2ccc(cc2)O)C)/C=C\3/C(=O)NC(=S)N(C3=O)c4ccc(cc4)OC |
InChi: | InChI=1S/C24H21N3O4S/c1-14-12-16(15(2)26(14)17-4-8-19(28)9-5-17)13-21-22(29)25-24(32)27(23(21)30)18-6-10-20(31-3)11-7-18/h4-13,28H,1-3H3,(H,25,29,32)/b21-13- |
InChiKey: | InChIKey=KZOLAHDQMRJHQG-BKUYFWCQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.