* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL087058 |
English Synonyms: | SYNTHON-LAB SL087058 |
MDL Number.: | MFCD04023517 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | C=CCn1c(nnc1SCC(=O)Nc2ccc(c(c2)F)F)c3ccncc3 |
InChi: | InChI=1S/C18H15F2N5OS/c1-2-9-25-17(12-5-7-21-8-6-12)23-24-18(25)27-11-16(26)22-13-3-4-14(19)15(20)10-13/h2-8,10H,1,9,11H2,(H,22,26) |
InChiKey: | InChIKey=ZBADYKSRFBEICW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.