* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL037876 |
| English Synonyms: | SYNTHON-LAB SL037876 |
| MDL Number.: | MFCD04023862 |
| H bond acceptor: | 8 |
| H bond donor: | 0 |
| Smile: | Cc1ccc(nc1)n2c(cc(c2C)/C=C/3\C(=O)N(C(=O)S3)CC(=O)N4CCOCC4)C |
| InChi: | InChI=1S/C22H24N4O4S/c1-14-4-5-19(23-12-14)26-15(2)10-17(16(26)3)11-18-21(28)25(22(29)31-18)13-20(27)24-6-8-30-9-7-24/h4-5,10-12H,6-9,13H2,1-3H3/b18-11+ |
| InChiKey: | InChIKey=OCHHTFWFRKTVHQ-WOJGMQOQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.