* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL037879 |
English Synonyms: | SYNTHON-LAB SL037879 |
MDL Number.: | MFCD04024388 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | c1cc(ccc1c2ccc(o2)/C=C/3\C(=O)N(C(=O)S3)CC(=O)N4CCOCC4)F |
InChi: | InChI=1S/C20H17FN2O5S/c21-14-3-1-13(2-4-14)16-6-5-15(28-16)11-17-19(25)23(20(26)29-17)12-18(24)22-7-9-27-10-8-22/h1-6,11H,7-10,12H2/b17-11+ |
InChiKey: | InChIKey=JFKKNCIHAKQOAN-GZTJUZNOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.