* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL032048 |
English Synonyms: | SYNTHON-LAB SL032048 |
MDL Number.: | MFCD04031730 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | c1ccc2c(c1)c(cn2CC(=O)Nc3ccc(cc3)Cl)/C=C/4\C(=O)NC(=O)N(C4=O)c5cccc(c5)F |
InChi: | InChI=1S/C27H18ClFN4O4/c28-17-8-10-19(11-9-17)30-24(34)15-32-14-16(21-6-1-2-7-23(21)32)12-22-25(35)31-27(37)33(26(22)36)20-5-3-4-18(29)13-20/h1-14H,15H2,(H,30,34)(H,31,35,37)/b22-12+ |
InChiKey: | InChIKey=VBUJCCAAVRQKFY-WSDLNYQXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.