* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL030981 |
English Synonyms: | SYNTHON-LAB SL030981 |
MDL Number.: | MFCD04031792 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | CCOc1cc(cc(c1O)[N+](=O)[O-])/C=c/2\c(=O)n3c4ccccc4nc3s2 |
InChi: | InChI=1S/C18H13N3O5S/c1-2-26-14-8-10(7-13(16(14)22)21(24)25)9-15-17(23)20-12-6-4-3-5-11(12)19-18(20)27-15/h3-9,22H,2H2,1H3/b15-9+ |
InChiKey: | InChIKey=AYZORGOQPFBWJA-OQLLNIDSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.