* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL094455 |
| English Synonyms: | SYNTHON-LAB SL094455 |
| MDL Number.: | MFCD04032069 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | c1cc(cc(c1)Cl)c2nc3n(n2)c(=O)/c(=C/c4ccc(c(c4)Cl)Cl)/s3 |
| InChi: | InChI=1S/C17H8Cl3N3OS/c18-11-3-1-2-10(8-11)15-21-17-23(22-15)16(24)14(25-17)7-9-4-5-12(19)13(20)6-9/h1-8H/b14-7- |
| InChiKey: | InChIKey=YEEUPXDCABJTPS-AUWJEWJLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.