* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL034570 |
English Synonyms: | SYNTHON-LAB SL034570 |
MDL Number.: | MFCD04032213 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | Cc1cc(c(n1c2ccc3c(c2)OCO3)C)/C=N/n4cnnc4 |
InChi: | InChI=1S/C16H15N5O2/c1-11-5-13(7-19-20-8-17-18-9-20)12(2)21(11)14-3-4-15-16(6-14)23-10-22-15/h3-9H,10H2,1-2H3/b19-7+ |
InChiKey: | InChIKey=LRVCUKXJBKDYET-FBCYGCLPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.