* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL053189 |
English Synonyms: | SYNTHON-LAB SL053189 |
MDL Number.: | MFCD04032237 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | CCc1ccc(cc1)/C=N/NC(=O)C(=O)NCCCN2CCOCC2 |
InChi: | InChI=1S/C18H26N4O3/c1-2-15-4-6-16(7-5-15)14-20-21-18(24)17(23)19-8-3-9-22-10-12-25-13-11-22/h4-7,14H,2-3,8-13H2,1H3,(H,19,23)(H,21,24)/b20-14+ |
InChiKey: | InChIKey=PRKDWUGMAIFIPL-XSFVSMFZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.