Molecular Structure:
CCD No.:CCD00440388
BUTTPARK 59\40-55
Formula:C19 H11 N5 O2
MolWeight:341.329
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | BUTTPARK 59\40-55 |
| English Synonyms： | BUTTPARK 59\40-55 |
| MDL Number.： | MFCD04035893 |
| H bond acceptor： | 7 |
| H bond donor： | 0 |
| Smile： | c1ccc(cc1)n2cc(c(n2)c3ccc(cc3)[N+](=O)[O-])C=C(C#N)C#N |
| InChi： | InChI=1S/C19H11N5O2/c20-11-14(12-21)10-16-13-23(17-4-2-1-3-5-17)22-19(16)15-6-8-18(9-7-15)24(25)26/h1-10,13H |
| InChiKey： | InChIKey=OPXMFDMZKMUVDU-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
