Molecular Structure:
CCD No.:CCD00440402
BUTTPARK 59\40-81
Formula:C28 H18 N6 O3 S
MolWeight:518.555
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | BUTTPARK 59\40-81 |
| English Synonyms： | BUTTPARK 59\40-81 |
| MDL Number.： | MFCD04035907 |
| H bond acceptor： | 9 |
| H bond donor： | 0 |
| Smile： | Cc1c(cn(n1)c2ccccc2)/C=N/n3cnc4c5c(cc(nc5oc4c3=O)c6cccs6)c7ccco7 |
| InChi： | InChI=1S/C28H18N6O3S/c1-17-18(15-33(32-17)19-7-3-2-4-8-19)14-30-34-16-29-25-24-20(22-9-5-11-36-22)13-21(23-10-6-12-38-23)31-27(24)37-26(25)28(34)35/h2-16H,1H3/b30-14+ |
| InChiKey： | InChIKey=KSBUBDXGDSXFOZ-AMVVHIIESA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
