Molecular Structure:
CCD No.:CCD00440407
BUTTPARK 59\40-86
Formula:C24 H18 N4 O3 S
MolWeight:442.497
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | BUTTPARK 59\40-86 |
| English Synonyms： | BUTTPARK 59\40-86 |
| MDL Number.： | MFCD04035912 |
| H bond acceptor： | 7 |
| H bond donor： | 2 |
| Smile： | Cc1ccc(cc1)c2cc(c3c(c(oc3n2)C(=O)N/N=C/c4cccs4)N)c5ccco5 |
| InChi： | InChI=1S/C24H18N4O3S/c1-14-6-8-15(9-7-14)18-12-17(19-5-2-10-30-19)20-21(25)22(31-24(20)27-18)23(29)28-26-13-16-4-3-11-32-16/h2-13H,25H2,1H3,(H,28,29)/b26-13+ |
| InChiKey： | InChIKey=MERWCOGTNBCAMT-LGJNPRDNSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
