Molecular Structure:
CCD No.:CCD00440865
BUTTPARK 66\41-59
Formula:C12 H12 F N3 O2 S
MolWeight:281.31
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | BUTTPARK 66\41-59 |
| English Synonyms： | BUTTPARK 66\41-59 |
| MDL Number.： | MFCD04036370 |
| H bond acceptor： | 5 |
| H bond donor： | 0 |
| Smile： | Cn1c(nnc1SCC(=O)OC)c2cccc(c2)F |
| InChi： | InChI=1S/C12H12FN3O2S/c1-16-11(8-4-3-5-9(13)6-8)14-15-12(16)19-7-10(17)18-2/h3-6H,7H2,1-2H3 |
| InChiKey： | InChIKey=AIQCHEHJWJQKHA-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
