Molecular Structure:
CCD No.:CCD00440904
BUTTPARK 67\41-04
Formula:C22 H15 F3 N4 O S
MolWeight:440.448
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | BUTTPARK 67\41-04 |
| English Synonyms： | BUTTPARK 67\41-04 |
| MDL Number.： | MFCD04036409 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | c1ccc(cc1)n2c(nnc2SCC(=O)Nc3cc(cc(c3)F)F)c4ccc(cc4)F |
| InChi： | InChI=1S/C22H15F3N4OS/c23-15-8-6-14(7-9-15)21-27-28-22(29(21)19-4-2-1-3-5-19)31-13-20(30)26-18-11-16(24)10-17(25)12-18/h1-12H,13H2,(H,26,30) |
| InChiKey： | InChIKey=OHXYVOYFPURWGE-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
