Molecular Structure:
CCD No.:CCD00440911
BUTTPARK 67\41-11
Formula:C15 H18 F2 N4 O S
MolWeight:340.396
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | BUTTPARK 67\41-11 |
| English Synonyms： | BUTTPARK 67\41-11 |
| MDL Number.： | MFCD04036416 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | CC(C)(C)NC(=O)CSc1nnc(n1C)c2ccc(cc2F)F |
| InChi： | InChI=1S/C15H18F2N4OS/c1-15(2,3)18-12(22)8-23-14-20-19-13(21(14)4)10-6-5-9(16)7-11(10)17/h5-7H,8H2,1-4H3,(H,18,22) |
| InChiKey： | InChIKey=QRNDPEHCPRPPGS-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
