Molecular Structure:
CCD No.:CCD00440925
BUTTPARK 67\41-25
Formula:C11 H9 F2 N3 O2 S
MolWeight:285.273
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | BUTTPARK 67\41-25 |
| English Synonyms： | BUTTPARK 67\41-25 |
| MDL Number.： | MFCD04036430 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | Cn1c(nnc1SCC(=O)O)c2cc(cc(c2)F)F |
| InChi： | InChI=1S/C11H9F2N3O2S/c1-16-10(6-2-7(12)4-8(13)3-6)14-15-11(16)19-5-9(17)18/h2-4H,5H2,1H3,(H,17,18) |
| InChiKey： | InChIKey=OEFRKAYEYVJTHA-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
