Molecular Structure:
CCD No.:CCD00440982
BUTTPARK 67\41-82
Formula:C16 H19 F3 N4 O S
MolWeight:372.413
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | BUTTPARK 67\41-82 |
| English Synonyms： | BUTTPARK 67\41-82 |
| MDL Number.： | MFCD04036487 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | CC(C)(C)NC(=O)CSc1nnc(n1C)c2cccc(c2)C(F)(F)F |
| InChi： | InChI=1S/C16H19F3N4OS/c1-15(2,3)20-12(24)9-25-14-22-21-13(23(14)4)10-6-5-7-11(8-10)16(17,18)19/h5-8H,9H2,1-4H3,(H,20,24) |
| InChiKey： | InChIKey=RCTOCRFGPMDGDV-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
