* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BUTTPARK 67\41-91 |
| English Synonyms: | BUTTPARK 67\41-91 |
| MDL Number.: | MFCD04036496 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | COc1ccc(cc1)NC(=O)CSc2nnc(n2c3ccccc3)c4cccc(c4)C(F)(F)F |
| InChi: | InChI=1S/C24H19F3N4O2S/c1-33-20-12-10-18(11-13-20)28-21(32)15-34-23-30-29-22(31(23)19-8-3-2-4-9-19)16-6-5-7-17(14-16)24(25,26)27/h2-14H,15H2,1H3,(H,28,32) |
| InChiKey: | InChIKey=ARGBNGVWCCUNQJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.