Molecular Structure:
CCD No.:CCD00441069
BUTTPARK 68\41-79
Formula:C16 H22 N4 O2 S
MolWeight:334.442
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | BUTTPARK 68\41-79 |
| English Synonyms： | BUTTPARK 68\41-79 |
| MDL Number.： | MFCD04036574 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | CC(C)(C)NC(=O)CSc1nnc(n1C)c2cccc(c2)OC |
| InChi： | InChI=1S/C16H22N4O2S/c1-16(2,3)17-13(21)10-23-15-19-18-14(20(15)4)11-7-6-8-12(9-11)22-5/h6-9H,10H2,1-5H3,(H,17,21) |
| InChiKey： | InChIKey=SWXVOXWTLANDKP-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
