* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BIS(2,2,3,3,4,4,5,5,6,6,7,7-DODECAFLUOROHEPTYL) SULFOSUCCINATE SODIUM SALT |
| CAS: | 60131-27-3 |
| English Synonyms: | BIS(2,2,3,3,4,4,5,5,6,6,7,7-DODECAFLUOROHEPTYL) SULFOSUCCINATE SODIUM SALT |
| MDL Number.: | MFCD04038091 |
| H bond acceptor: | 7 |
| H bond donor: | 0 |
| Smile: | C(C(C(=O)OCC(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)S(=O)(=O)[O-])C(=O)OCC(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(F)F)(F)F.[Na+] |
| InChi: | InChI=1S/C18H10F24O7S.Na/c19-7(20)11(27,28)15(35,36)17(39,40)13(31,32)9(23,24)2-48-5(43)1-4(50(45,46)47)6(44)49-3-10(25,26)14(33,34)18(41,42)16(37,38)12(29,30)8(21)22;/h4,7-8H,1-3H2,(H,45,46,47);/q;+1/p-1 |
| InChiKey: | InChIKey=JNCXDUZXQNOCOB-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.