* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BIOCYTIN-L-PROLINE |
| CAS: | 1356931-03-7 |
| English Synonyms: | BIOCYTIN-L-PROLINE |
| MDL Number.: | MFCD04039423 |
| H bond acceptor: | 10 |
| H bond donor: | 5 |
| Smile: | C1C[C@H](N(C1)C(=O)[C@H](CCCCNC(=O)CCCC[C@H]2[C@@H]3[C@H](CS2)NC(=O)N3)N)C(=O)O |
| InChi: | InChI=1S/C21H35N5O5S/c22-13(19(28)26-11-5-7-15(26)20(29)30)6-3-4-10-23-17(27)9-2-1-8-16-18-14(12-32-16)24-21(31)25-18/h13-16,18H,1-12,22H2,(H,23,27)(H,29,30)(H2,24,25,31)/t13-,14-,15-,16-,18-/m0/s1 |
| InChiKey: | InChIKey=LXFMAOOXLATVPN-DNCCFGNJSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.