* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9,10-DICHLORO-2,6(7)-DIMETHYLANTHRACENE |
| English Synonyms: | 9,10-DICHLORO-2,6(7)-DIMETHYLANTHRACENE |
| MDL Number.: | MFCD04039512 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | Cc1ccc2c(c1)c(c3cc(ccc3c2Cl)C)Cl |
| InChi: | InChI=1S/C16H12Cl2/c1-9-3-5-11-13(7-9)16(18)14-8-10(2)4-6-12(14)15(11)17/h3-8H,1-2H3 |
| InChiKey: | InChIKey=JTCJHOLNRWWKGY-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.