* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB023339 |
| English Synonyms: | VITAS-BB TBB023339 |
| MDL Number.: | MFCD04054314 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | C\C(=N/NC(=O)C1=C(Cl)C2=C(S1)C=CC=C2)C1=CC=C(NC(=O)C2=CC=CO2)C=C1 |
| InChi: | InChI=1S/C22H16ClN3O3S/c1-13(14-8-10-15(11-9-14)24-21(27)17-6-4-12-29-17)25-26-22(28)20-19(23)16-5-2-3-7-18(16)30-20/h2-12H,1H3,(H,24,27)(H,26,28)/b25-13+ |
| InChiKey: | InChIKey=HUVCGRHJKGOWHS-DHRITJCHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.