* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL091497 |
English Synonyms: | SYNTHON-LAB SL091497 |
MDL Number.: | MFCD04055821 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCCN1C(=O)/C(=C/c2cccs2)/SC1=S |
InChi: | InChI=1S/C11H11NOS3/c1-2-5-12-10(13)9(16-11(12)14)7-8-4-3-6-15-8/h3-4,6-7H,2,5H2,1H3/b9-7- |
InChiKey: | InChIKey=AUABYSKUBPFWHM-CLFYSBASSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.