* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL092339 |
English Synonyms: | SYNTHON-LAB SL092339 |
MDL Number.: | MFCD04055822 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CCCN1C(=O)/C(=C/c2ccc(c(c2)OC)OC)/SC1=S |
InChi: | InChI=1S/C15H17NO3S2/c1-4-7-16-14(17)13(21-15(16)20)9-10-5-6-11(18-2)12(8-10)19-3/h5-6,8-9H,4,7H2,1-3H3/b13-9- |
InChiKey: | InChIKey=FCJCZGSWJFPWKU-LCYFTJDESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.