* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL084524 |
| English Synonyms: | SYNTHON-LAB SL084524 |
| MDL Number.: | MFCD04085891 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | Cc1cccc(c1)C(=O)NCc2nnc(n2C)SCC(=O)Nc3nc(c(s3)C)c4ccccc4 |
| InChi: | InChI=1S/C24H24N6O2S2/c1-15-8-7-11-18(12-15)22(32)25-13-19-28-29-24(30(19)3)33-14-20(31)26-23-27-21(16(2)34-23)17-9-5-4-6-10-17/h4-12H,13-14H2,1-3H3,(H,25,32)(H,26,27,31) |
| InChiKey: | InChIKey=FAFJPWQBOHEQMV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.