* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL085390 |
English Synonyms: | SYNTHON-LAB SL085390 |
MDL Number.: | MFCD04085904 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC1=C(C(NC(=N1)S)c2ccc(cc2)C(C)(C)C)C(=O)OCCOC |
InChi: | InChI=1S/C19H26N2O3S/c1-12-15(17(22)24-11-10-23-5)16(21-18(25)20-12)13-6-8-14(9-7-13)19(2,3)4/h6-9,16H,10-11H2,1-5H3,(H2,20,21,25) |
InChiKey: | InChIKey=XCDHPNJVYRZALB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.