* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL085349 |
| English Synonyms: | SYNTHON-LAB SL085349 |
| MDL Number.: | MFCD04085912 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CCCCOc1ccc(cc1OCC)C2C(=C(N=C(N2)S)C)C(=O)Nc3ccccc3 |
| InChi: | InChI=1S/C24H29N3O3S/c1-4-6-14-30-19-13-12-17(15-20(19)29-5-2)22-21(16(3)25-24(31)27-22)23(28)26-18-10-8-7-9-11-18/h7-13,15,22H,4-6,14H2,1-3H3,(H,26,28)(H2,25,27,31) |
| InChiKey: | InChIKey=FZZFVPLLCPFSKZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.