* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL085408 |
| English Synonyms: | SYNTHON-LAB SL085408 |
| MDL Number.: | MFCD04085929 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CC1=C(C(NC(=N1)S)c2ccc(cc2)C(C)(C)C)C(=O)Nc3ccccc3 |
| InChi: | InChI=1S/C22H25N3OS/c1-14-18(20(26)24-17-8-6-5-7-9-17)19(25-21(27)23-14)15-10-12-16(13-11-15)22(2,3)4/h5-13,19H,1-4H3,(H,24,26)(H2,23,25,27) |
| InChiKey: | InChIKey=FKZYJXLSCPSDHL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.