* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL086159 |
English Synonyms: | SYNTHON-LAB SL086159 |
MDL Number.: | MFCD04086102 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | Cc1cccc(c1OCC(=O)NCc2nnc(n2C)SCC(=O)Nc3c(cc(cc3C)Br)C)C |
InChi: | InChI=1S/C24H28BrN5O3S/c1-14-7-6-8-15(2)23(14)33-12-20(31)26-11-19-28-29-24(30(19)5)34-13-21(32)27-22-16(3)9-18(25)10-17(22)4/h6-10H,11-13H2,1-5H3,(H,26,31)(H,27,32) |
InChiKey: | InChIKey=TXUHCJRXOLIGKI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.