* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL092916 |
English Synonyms: | SYNTHON-LAB SL092916 |
MDL Number.: | MFCD04086928 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | COc1ccc(cc1OC)/C=C\2/C(=O)N(C(=S)N2)C3CCCCC3 |
InChi: | InChI=1S/C18H22N2O3S/c1-22-15-9-8-12(11-16(15)23-2)10-14-17(21)20(18(24)19-14)13-6-4-3-5-7-13/h8-11,13H,3-7H2,1-2H3,(H,19,24)/b14-10- |
InChiKey: | InChIKey=SUHYVJNULMDDIP-UVTDQMKNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.