* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL093253 |
| English Synonyms: | SYNTHON-LAB SL093253 |
| MDL Number.: | MFCD04086953 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCN(CC)c1ccc(cc1)/C=C\2/C(=O)N(C(=S)N2)C3CCCCC3 |
| InChi: | InChI=1S/C20H27N3OS/c1-3-22(4-2)16-12-10-15(11-13-16)14-18-19(24)23(20(25)21-18)17-8-6-5-7-9-17/h10-14,17H,3-9H2,1-2H3,(H,21,25)/b18-14- |
| InChiKey: | InChIKey=OOILCPJHIRDBSU-JXAWBTAJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.