* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL035425 |
English Synonyms: | SYNTHON-LAB SL035425 |
MDL Number.: | MFCD04087216 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | Cc1cccc(c1)NC(=O)CN2C(=O)/C(=C\c3c4ccccc4ccc3OCC#C)/NC2=O |
InChi: | InChI=1S/C26H21N3O4/c1-3-13-33-23-12-11-18-8-4-5-10-20(18)21(23)15-22-25(31)29(26(32)28-22)16-24(30)27-19-9-6-7-17(2)14-19/h1,4-12,14-15H,13,16H2,2H3,(H,27,30)(H,28,32)/b22-15+ |
InChiKey: | InChIKey=XPMZEHWAVTYCNF-PXLXIMEGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.